C11H6Cl3NO — CID 133092614
5-(2,3,6-trichlorophenyl)-1H-pyridin-2-one (PubChem CID 133092614) has the molecular formula C11H6Cl3NO and a molecular weight of 274.53 g/mol. Its IUPAC name is 5-(2,3,6-trichlorophenyl)-1H-pyridin-2-one.
| Compound Name | 5-(2,3,6-trichlorophenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 133092614 |
| Molecular Formula | C11H6Cl3NO |
| Molecular Weight | 274.53 g/mol |
| Exact Mass | 272.95 |
| IUPAC Name | 5-(2,3,6-trichlorophenyl)-1H-pyridin-2-one |
| SMILES | O=c1ccc(-c2c(Cl)ccc(Cl)c2Cl)c[nH]1 |
| InChI | InChI=1S/C11H6Cl3NO/c12-7-2-3-8(13)11(14)10(7)6-1-4-9(16)15-5-6/h1-5H,(H,15,16) |
| InChIKey | AAMLZBLSTUIIOK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|