About 5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one
5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one (PubChem CID 136742850) has the molecular formula C14H9Cl2N3O2
and a molecular weight of 322.15 g/mol. Its IUPAC name is 5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one |
| PubChem CID | 136742850 |
| Molecular Formula | C14H9Cl2N3O2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one |
| SMILES | Nc1noc(-c2ccc(=O)[nH]c2)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2N3O2/c15-9-3-1-7(5-10(9)16)12-13(21-19-14(12)17)8-2-4-11(20)18-6-8/h1-6H,(H2,17,19)(H,18,20) |
| InChIKey | UPKBIAADZGDBMY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one?
The IUPAC name of 5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one (CID 136742850) is 5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one.
What is the SMILES notation for 5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one?
The canonical SMILES for 5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one is Nc1noc(-c2ccc(=O)[nH]c2)c1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one?
The InChIKey is UPKBIAADZGDBMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl2N3O2/c15-9-3-1-7(5-10(9)16)12-13(21-19-14(12)17)8-2-4-11(20)18-6-8/h1-6H,(H2,17,19)(H,18,20).
What are the key properties of 5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one?
5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one has a molecular weight of 322.15 g/mol, XLogP of 3.59, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-amino-4-(3,4-dichlorophenyl)-1,2-oxazol-5-yl]-1H-pyridin-2-one is sourced from PubChem (CID 136742850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).