C13H8Cl3NO3 — CID 133092680
methyl 6-oxo-5-(2,3,5-trichlorophenyl)-1H-pyridine-3-carboxylate (PubChem CID 133092680) has the molecular formula C13H8Cl3NO3 and a molecular weight of 332.57 g/mol. Its IUPAC name is methyl 6-oxo-5-(2,3,5-trichlorophenyl)-1H-pyridine-3-carboxylate.
| Compound Name | methyl 6-oxo-5-(2,3,5-trichlorophenyl)-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133092680 |
| Molecular Formula | C13H8Cl3NO3 |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | methyl 6-oxo-5-(2,3,5-trichlorophenyl)-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1c[nH]c(=O)c(-c2cc(Cl)cc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C13H8Cl3NO3/c1-20-13(19)6-2-9(12(18)17-5-6)8-3-7(14)4-10(15)11(8)16/h2-5H,1H3,(H,17,18) |
| InChIKey | KKQBNJIKFAVRBW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|