C18H11Cl4NO — CID 133092886
3,5-bis(3,5-dichlorophenyl)-6-methyl-1H-pyridin-2-one (PubChem CID 133092886) has the molecular formula C18H11Cl4NO and a molecular weight of 399.10 g/mol. Its IUPAC name is 3,5-bis(3,5-dichlorophenyl)-6-methyl-1H-pyridin-2-one.
| Compound Name | 3,5-bis(3,5-dichlorophenyl)-6-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 133092886 |
| Molecular Formula | C18H11Cl4NO |
| Molecular Weight | 399.10 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | 3,5-bis(3,5-dichlorophenyl)-6-methyl-1H-pyridin-2-one |
| SMILES | Cc1[nH]c(=O)c(-c2cc(Cl)cc(Cl)c2)cc1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H11Cl4NO/c1-9-16(10-2-12(19)6-13(20)3-10)8-17(18(24)23-9)11-4-14(21)7-15(22)5-11/h2-8H,1H3,(H,23,24) |
| InChIKey | GHHOJNFOHKSCGG-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.10 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |