C12H3ClF5NO — CID 133093625
5-chloro-3-(2,3,4,5,6-pentafluorophenyl)pyridine-2-carbaldehyde (PubChem CID 133093625) has the molecular formula C12H3ClF5NO and a molecular weight of 307.61 g/mol. Its IUPAC name is 5-chloro-3-(2,3,4,5,6-pentafluorophenyl)pyridine-2-carbaldehyde.
| Compound Name | 5-chloro-3-(2,3,4,5,6-pentafluorophenyl)pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 133093625 |
| Molecular Formula | C12H3ClF5NO |
| Molecular Weight | 307.61 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 5-chloro-3-(2,3,4,5,6-pentafluorophenyl)pyridine-2-carbaldehyde |
| SMILES | O=Cc1ncc(Cl)cc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H3ClF5NO/c13-4-1-5(6(3-20)19-2-4)7-8(14)10(16)12(18)11(17)9(7)15/h1-3H |
| InChIKey | RPHBTMQQJRNIFQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.61 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|