C21H12F6N2O2 — CID 133094083
2-[3,6-bis[4-(trifluoromethoxy)phenyl]-2-pyridinyl]acetonitrile (PubChem CID 133094083) has the molecular formula C21H12F6N2O2 and a molecular weight of 438.33 g/mol. Its IUPAC name is 2-[3,6-bis[4-(trifluoromethoxy)phenyl]-2-pyridinyl]acetonitrile.
| Compound Name | 2-[3,6-bis[4-(trifluoromethoxy)phenyl]-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 133094083 |
| Molecular Formula | C21H12F6N2O2 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 2-[3,6-bis[4-(trifluoromethoxy)phenyl]-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1nc(-c2ccc(OC(F)(F)F)cc2)ccc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H12F6N2O2/c22-20(23,24)30-15-5-1-13(2-6-15)17-9-10-18(29-19(17)11-12-28)14-3-7-16(8-4-14)31-21(25,26)27/h1-10H,11H2 |
| InChIKey | OOJVVDBAIFLKKT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |