About 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile
2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile (PubChem CID 133094241) has the molecular formula C15H11N3
and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile |
| PubChem CID | 133094241 |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile |
| SMILES | N#CCc1cc2cc[nH]c2nc1-c1ccccc1 |
| InChI | InChI=1S/C15H11N3/c16-8-6-12-10-13-7-9-17-15(13)18-14(12)11-4-2-1-3-5-11/h1-5,7,9-10H,6H2,(H,17,18) |
| InChIKey | QFEFZTZBZUOEPX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile?
The IUPAC name of 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile (CID 133094241) is 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile.
What is the SMILES notation for 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile?
The canonical SMILES for 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile is N#CCc1cc2cc[nH]c2nc1-c1ccccc1.
What is the InChIKey of 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile?
The InChIKey is QFEFZTZBZUOEPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3/c16-8-6-12-10-13-7-9-17-15(13)18-14(12)11-4-2-1-3-5-11/h1-5,7,9-10H,6H2,(H,17,18).
What are the key properties of 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile?
2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile has a molecular weight of 233.27 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile is sourced from PubChem (CID 133094241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).