C15H11N3 — CID 133094241
2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile (PubChem CID 133094241) has the molecular formula C15H11N3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile.
| Compound Name | 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile |
|---|---|
| PubChem CID | 133094241 |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-(6-phenyl-1H-pyrrolo[2,3-b]pyridin-5-yl)acetonitrile |
| SMILES | N#CCc1cc2cc[nH]c2nc1-c1ccccc1 |
| InChI | InChI=1S/C15H11N3/c16-8-6-12-10-13-7-9-17-15(13)18-14(12)11-4-2-1-3-5-11/h1-5,7,9-10H,6H2,(H,17,18) |
| InChIKey | QFEFZTZBZUOEPX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |