C24H14N4O — CID 137438727
6-(5-oxo-2-phenyl-8H-1,8-naphthyridin-3-yl)quinoline-2-carbonitrile (PubChem CID 137438727) has the molecular formula C24H14N4O and a molecular weight of 374.40 g/mol. Its IUPAC name is 6-(5-oxo-2-phenyl-8H-1,8-naphthyridin-3-yl)quinoline-2-carbonitrile.
| Compound Name | 6-(5-oxo-2-phenyl-8H-1,8-naphthyridin-3-yl)quinoline-2-carbonitrile |
|---|---|
| PubChem CID | 137438727 |
| Molecular Formula | C24H14N4O |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 6-(5-oxo-2-phenyl-8H-1,8-naphthyridin-3-yl)quinoline-2-carbonitrile |
| SMILES | N#Cc1ccc2cc(-c3cc4c(=O)cc[nH]c4nc3-c3ccccc3)ccc2n1 |
| InChI | InChI=1S/C24H14N4O/c25-14-18-8-6-17-12-16(7-9-21(17)27-18)19-13-20-22(29)10-11-26-24(20)28-23(19)15-4-2-1-3-5-15/h1-13H,(H,26,28,29) |
| InChIKey | JVWOSYSQDLZNEJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |