C23H15N3O — CID 137423248
7-phenyl-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one (PubChem CID 137423248) has the molecular formula C23H15N3O and a molecular weight of 349.39 g/mol. Its IUPAC name is 7-phenyl-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one.
| Compound Name | 7-phenyl-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 137423248 |
| Molecular Formula | C23H15N3O |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 7-phenyl-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one |
| SMILES | O=c1cc[nH]c2nc(-c3ccccc3)c(-c3ccc4ncccc4c3)cc12 |
| InChI | InChI=1S/C23H15N3O/c27-21-10-12-25-23-19(21)14-18(22(26-23)15-5-2-1-3-6-15)16-8-9-20-17(13-16)7-4-11-24-20/h1-14H,(H,25,26,27) |
| InChIKey | PLSWRCPHSIXWSP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |