C24H13FN4O — CID 154604858
2-fluoro-3-(5-oxo-3-quinolin-6-yl-8H-1,8-naphthyridin-2-yl)benzonitrile (PubChem CID 154604858) has the molecular formula C24H13FN4O and a molecular weight of 392.39 g/mol. Its IUPAC name is 2-fluoro-3-(5-oxo-3-quinolin-6-yl-8H-1,8-naphthyridin-2-yl)benzonitrile.
| Compound Name | 2-fluoro-3-(5-oxo-3-quinolin-6-yl-8H-1,8-naphthyridin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 154604858 |
| Molecular Formula | C24H13FN4O |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-fluoro-3-(5-oxo-3-quinolin-6-yl-8H-1,8-naphthyridin-2-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2nc3[nH]ccc(=O)c3cc2-c2ccc3ncccc3c2)c1F |
| InChI | InChI=1S/C24H13FN4O/c25-22-16(13-26)3-1-5-17(22)23-18(12-19-21(30)8-10-28-24(19)29-23)14-6-7-20-15(11-14)4-2-9-27-20/h1-12H,(H,28,29,30) |
| InChIKey | QSIXQKPHTNDGHR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |