C22H16N4O — CID 137438504
7-(5-methyl-1H-pyrrol-2-yl)-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one (PubChem CID 137438504) has the molecular formula C22H16N4O and a molecular weight of 352.40 g/mol. Its IUPAC name is 7-(5-methyl-1H-pyrrol-2-yl)-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one.
| Compound Name | 7-(5-methyl-1H-pyrrol-2-yl)-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 137438504 |
| Molecular Formula | C22H16N4O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 7-(5-methyl-1H-pyrrol-2-yl)-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one |
| SMILES | Cc1ccc(-c2nc3[nH]ccc(=O)c3cc2-c2ccc3ncccc3c2)[nH]1 |
| InChI | InChI=1S/C22H16N4O/c1-13-4-6-19(25-13)21-16(12-17-20(27)8-10-24-22(17)26-21)14-5-7-18-15(11-14)3-2-9-23-18/h2-12,25H,1H3,(H,24,26,27) |
| InChIKey | BYTDTWFTGVJWBI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |