C20H14N6O — CID 137438402
7-(2-methyltriazol-4-yl)-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one (PubChem CID 137438402) has the molecular formula C20H14N6O and a molecular weight of 354.37 g/mol. Its IUPAC name is 7-(2-methyltriazol-4-yl)-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one.
| Compound Name | 7-(2-methyltriazol-4-yl)-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 137438402 |
| Molecular Formula | C20H14N6O |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 7-(2-methyltriazol-4-yl)-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one |
| SMILES | Cn1ncc(-c2nc3[nH]ccc(=O)c3cc2-c2ccc3ncccc3c2)n1 |
| InChI | InChI=1S/C20H14N6O/c1-26-23-11-17(25-26)19-14(10-15-18(27)6-8-22-20(15)24-19)12-4-5-16-13(9-12)3-2-7-21-16/h2-11H,1H3,(H,22,24,27) |
| InChIKey | YCOTYOYFFYVRHA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |