C25H16N4O — CID 154604994
2-methyl-3-(5-oxo-3-quinolin-6-yl-8H-1,8-naphthyridin-2-yl)benzonitrile (PubChem CID 154604994) has the molecular formula C25H16N4O and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-methyl-3-(5-oxo-3-quinolin-6-yl-8H-1,8-naphthyridin-2-yl)benzonitrile.
| Compound Name | 2-methyl-3-(5-oxo-3-quinolin-6-yl-8H-1,8-naphthyridin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 154604994 |
| Molecular Formula | C25H16N4O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-methyl-3-(5-oxo-3-quinolin-6-yl-8H-1,8-naphthyridin-2-yl)benzonitrile |
| SMILES | Cc1c(C#N)cccc1-c1nc2[nH]ccc(=O)c2cc1-c1ccc2ncccc2c1 |
| InChI | InChI=1S/C25H16N4O/c1-15-18(14-26)4-2-6-19(15)24-20(13-21-23(30)9-11-28-25(21)29-24)16-7-8-22-17(12-16)5-3-10-27-22/h2-13H,1H3,(H,28,29,30) |
| InChIKey | IEGLNMRIUDSAEK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |