C19H11N5O2 — CID 137437968
7-(1,3,4-oxadiazol-2-yl)-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one (PubChem CID 137437968) has the molecular formula C19H11N5O2 and a molecular weight of 341.33 g/mol. Its IUPAC name is 7-(1,3,4-oxadiazol-2-yl)-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one.
| Compound Name | 7-(1,3,4-oxadiazol-2-yl)-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 137437968 |
| Molecular Formula | C19H11N5O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 7-(1,3,4-oxadiazol-2-yl)-6-quinolin-6-yl-1H-1,8-naphthyridin-4-one |
| SMILES | O=c1cc[nH]c2nc(-c3nnco3)c(-c3ccc4ncccc4c3)cc12 |
| InChI | InChI=1S/C19H11N5O2/c25-16-5-7-21-18-14(16)9-13(17(23-18)19-24-22-10-26-19)11-3-4-15-12(8-11)2-1-6-20-15/h1-10H,(H,21,23,25) |
| InChIKey | INFPMRGYRGZABU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |