C19H12FN3O — CID 137438792
7-(4-fluorophenyl)-6-pyridin-4-yl-1H-1,8-naphthyridin-4-one (PubChem CID 137438792) has the molecular formula C19H12FN3O and a molecular weight of 317.32 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-6-pyridin-4-yl-1H-1,8-naphthyridin-4-one.
| Compound Name | 7-(4-fluorophenyl)-6-pyridin-4-yl-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 137438792 |
| Molecular Formula | C19H12FN3O |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 7-(4-fluorophenyl)-6-pyridin-4-yl-1H-1,8-naphthyridin-4-one |
| SMILES | O=c1cc[nH]c2nc(-c3ccc(F)cc3)c(-c3ccncc3)cc12 |
| InChI | InChI=1S/C19H12FN3O/c20-14-3-1-13(2-4-14)18-15(12-5-8-21-9-6-12)11-16-17(24)7-10-22-19(16)23-18/h1-11H,(H,22,23,24) |
| InChIKey | PFTUSKMOIIKXRM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |