C22H13ClN4O — CID 137438341
6-(8-chloroquinolin-6-yl)-7-pyridin-3-yl-1H-1,8-naphthyridin-4-one (PubChem CID 137438341) has the molecular formula C22H13ClN4O and a molecular weight of 384.83 g/mol. Its IUPAC name is 6-(8-chloroquinolin-6-yl)-7-pyridin-3-yl-1H-1,8-naphthyridin-4-one.
| Compound Name | 6-(8-chloroquinolin-6-yl)-7-pyridin-3-yl-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 137438341 |
| Molecular Formula | C22H13ClN4O |
| Molecular Weight | 384.83 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 6-(8-chloroquinolin-6-yl)-7-pyridin-3-yl-1H-1,8-naphthyridin-4-one |
| SMILES | O=c1cc[nH]c2nc(-c3cccnc3)c(-c3cc(Cl)c4ncccc4c3)cc12 |
| InChI | InChI=1S/C22H13ClN4O/c23-18-10-15(9-13-3-2-7-25-21(13)18)16-11-17-19(28)5-8-26-22(17)27-20(16)14-4-1-6-24-12-14/h1-12H,(H,26,27,28) |
| InChIKey | CUQIUEXKCXENRH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.83 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |