C21H14N4O — CID 154604829
6-imidazo[1,2-a]pyridin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one (PubChem CID 154604829) has the molecular formula C21H14N4O and a molecular weight of 338.37 g/mol. Its IUPAC name is 6-imidazo[1,2-a]pyridin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one.
| Compound Name | 6-imidazo[1,2-a]pyridin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 154604829 |
| Molecular Formula | C21H14N4O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 6-imidazo[1,2-a]pyridin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one |
| SMILES | O=c1cc[nH]c2nc(-c3ccccc3)c(-c3ccc4nccn4c3)cc12 |
| InChI | InChI=1S/C21H14N4O/c26-18-8-9-23-21-17(18)12-16(20(24-21)14-4-2-1-3-5-14)15-6-7-19-22-10-11-25(19)13-15/h1-13H,(H,23,24,26) |
| InChIKey | RBZZJAWRCBVAHN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |