C14H9Cl3N2O — CID 133094290
2-[5-methoxy-6-(2,3,6-trichlorophenyl)-2-pyridinyl]acetonitrile (PubChem CID 133094290) has the molecular formula C14H9Cl3N2O and a molecular weight of 327.60 g/mol. Its IUPAC name is 2-[5-methoxy-6-(2,3,6-trichlorophenyl)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[5-methoxy-6-(2,3,6-trichlorophenyl)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 133094290 |
| Molecular Formula | C14H9Cl3N2O |
| Molecular Weight | 327.60 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 2-[5-methoxy-6-(2,3,6-trichlorophenyl)-2-pyridinyl]acetonitrile |
| SMILES | COc1ccc(CC#N)nc1-c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C14H9Cl3N2O/c1-20-11-5-2-8(6-7-18)19-14(11)12-9(15)3-4-10(16)13(12)17/h2-5H,6H2,1H3 |
| InChIKey | WWXSCZJGFODQHE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|