C18H8Cl4N2 — CID 133095162
3,5-bis(2,3-dichlorophenyl)pyridine-2-carbonitrile (PubChem CID 133095162) has the molecular formula C18H8Cl4N2 and a molecular weight of 394.09 g/mol. Its IUPAC name is 3,5-bis(2,3-dichlorophenyl)pyridine-2-carbonitrile.
| Compound Name | 3,5-bis(2,3-dichlorophenyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133095162 |
| Molecular Formula | C18H8Cl4N2 |
| Molecular Weight | 394.09 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | 3,5-bis(2,3-dichlorophenyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ncc(-c2cccc(Cl)c2Cl)cc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H8Cl4N2/c19-14-5-1-3-11(17(14)21)10-7-13(16(8-23)24-9-10)12-4-2-6-15(20)18(12)22/h1-7,9H |
| InChIKey | RBYWKDAWNNNCBS-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.09 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |