C7HF3I2N2O — CID 133095491
4,5-diiodo-2-(trifluoromethoxy)pyridine-3-carbonitrile (PubChem CID 133095491) has the molecular formula C7HF3I2N2O and a molecular weight of 439.90 g/mol. Its IUPAC name is 4,5-diiodo-2-(trifluoromethoxy)pyridine-3-carbonitrile.
| Compound Name | 4,5-diiodo-2-(trifluoromethoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133095491 |
| Molecular Formula | C7HF3I2N2O |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.81 |
| IUPAC Name | 4,5-diiodo-2-(trifluoromethoxy)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(OC(F)(F)F)ncc(I)c1I |
| InChI | InChI=1S/C7HF3I2N2O/c8-7(9,10)15-6-3(1-13)5(12)4(11)2-14-6/h2H |
| InChIKey | PLBDTCZEEKAQOR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|