C10H8F4N2O — CID 133095951
2-[5-(fluoromethyl)-3-methyl-4-(trifluoromethoxy)-2-pyridinyl]acetonitrile (PubChem CID 133095951) has the molecular formula C10H8F4N2O and a molecular weight of 248.18 g/mol. Its IUPAC name is 2-[5-(fluoromethyl)-3-methyl-4-(trifluoromethoxy)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[5-(fluoromethyl)-3-methyl-4-(trifluoromethoxy)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 133095951 |
| Molecular Formula | C10H8F4N2O |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-[5-(fluoromethyl)-3-methyl-4-(trifluoromethoxy)-2-pyridinyl]acetonitrile |
| SMILES | Cc1c(CC#N)ncc(CF)c1OC(F)(F)F |
| InChI | InChI=1S/C10H8F4N2O/c1-6-8(2-3-15)16-5-7(4-11)9(6)17-10(12,13)14/h5H,2,4H2,1H3 |
| InChIKey | IORGOBHCJSMUKY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |