C12H7Cl2N3 — CID 133095973
5-amino-2-(3,4-dichlorophenyl)pyridine-3-carbonitrile (PubChem CID 133095973) has the molecular formula C12H7Cl2N3 and a molecular weight of 264.12 g/mol. Its IUPAC name is 5-amino-2-(3,4-dichlorophenyl)pyridine-3-carbonitrile.
| Compound Name | 5-amino-2-(3,4-dichlorophenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133095973 |
| Molecular Formula | C12H7Cl2N3 |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 5-amino-2-(3,4-dichlorophenyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cc(N)cnc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H7Cl2N3/c13-10-2-1-7(4-11(10)14)12-8(5-15)3-9(16)6-17-12/h1-4,6H,16H2 |
| InChIKey | XAXXDFMKZBQKII-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |