C10H7F5INO2 — CID 133100816
methyl 2-[3-(difluoromethyl)-5-iodo-2-(trifluoromethyl)-4-pyridinyl]acetate (PubChem CID 133100816) has the molecular formula C10H7F5INO2 and a molecular weight of 395.07 g/mol. Its IUPAC name is methyl 2-[3-(difluoromethyl)-5-iodo-2-(trifluoromethyl)-4-pyridinyl]acetate.
| Compound Name | methyl 2-[3-(difluoromethyl)-5-iodo-2-(trifluoromethyl)-4-pyridinyl]acetate |
|---|---|
| PubChem CID | 133100816 |
| Molecular Formula | C10H7F5INO2 |
| Molecular Weight | 395.07 g/mol |
| Exact Mass | 394.94 |
| IUPAC Name | methyl 2-[3-(difluoromethyl)-5-iodo-2-(trifluoromethyl)-4-pyridinyl]acetate |
| SMILES | COC(=O)Cc1c(I)cnc(C(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C10H7F5INO2/c1-19-6(18)2-4-5(16)3-17-8(10(13,14)15)7(4)9(11)12/h3,9H,2H2,1H3 |
| InChIKey | MJSRQJQQJMIJLF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.07 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|