C8H4F5NO3 — CID 133102250
3-(difluoromethyl)-5-hydroxy-4-(trifluoromethyl)pyridine-2-carboxylic acid (PubChem CID 133102250) has the molecular formula C8H4F5NO3 and a molecular weight of 257.11 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-hydroxy-4-(trifluoromethyl)pyridine-2-carboxylic acid.
| Compound Name | 3-(difluoromethyl)-5-hydroxy-4-(trifluoromethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 133102250 |
| Molecular Formula | C8H4F5NO3 |
| Molecular Weight | 257.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 3-(difluoromethyl)-5-hydroxy-4-(trifluoromethyl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ncc(O)c(C(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C8H4F5NO3/c9-6(10)3-4(8(11,12)13)2(15)1-14-5(3)7(16)17/h1,6,15H,(H,16,17) |
| InChIKey | QKLLZGXVIRETMM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.11 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |