C19H28O — CID 13310304
9-cyclohexyl-2,3,4,5,6,7,8,9-octahydro-1H-xanthene (PubChem CID 13310304) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is 9-cyclohexyl-2,3,4,5,6,7,8,9-octahydro-1H-xanthene.
| Compound Name | 9-cyclohexyl-2,3,4,5,6,7,8,9-octahydro-1H-xanthene |
|---|---|
| PubChem CID | 13310304 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 9-cyclohexyl-2,3,4,5,6,7,8,9-octahydro-1H-xanthene |
| SMILES | C1CCC(C2C3=C(CCCC3)OC3=C2CCCC3)CC1 |
| InChI | InChI=1S/C19H28O/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h14,19H,1-13H2 |
| InChIKey | PFFASKGNQSNEEB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |