C10H5F5N2O2 — CID 133106647
methyl 5-cyano-2-(difluoromethyl)-3-(trifluoromethyl)pyridine-4-carboxylate (PubChem CID 133106647) has the molecular formula C10H5F5N2O2 and a molecular weight of 280.15 g/mol. Its IUPAC name is methyl 5-cyano-2-(difluoromethyl)-3-(trifluoromethyl)pyridine-4-carboxylate.
| Compound Name | methyl 5-cyano-2-(difluoromethyl)-3-(trifluoromethyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 133106647 |
| Molecular Formula | C10H5F5N2O2 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | methyl 5-cyano-2-(difluoromethyl)-3-(trifluoromethyl)pyridine-4-carboxylate |
| SMILES | COC(=O)c1c(C#N)cnc(C(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C10H5F5N2O2/c1-19-9(18)5-4(2-16)3-17-7(8(11)12)6(5)10(13,14)15/h3,8H,1H3 |
| InChIKey | PFLQWGQJNLMTRP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |