C9H3F5N2O2 — CID 133107036
5-cyano-6-(difluoromethyl)-3-(trifluoromethyl)pyridine-2-carboxylic acid (PubChem CID 133107036) has the molecular formula C9H3F5N2O2 and a molecular weight of 266.12 g/mol. Its IUPAC name is 5-cyano-6-(difluoromethyl)-3-(trifluoromethyl)pyridine-2-carboxylic acid.
| Compound Name | 5-cyano-6-(difluoromethyl)-3-(trifluoromethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 133107036 |
| Molecular Formula | C9H3F5N2O2 |
| Molecular Weight | 266.12 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 5-cyano-6-(difluoromethyl)-3-(trifluoromethyl)pyridine-2-carboxylic acid |
| SMILES | N#Cc1cc(C(F)(F)F)c(C(=O)O)nc1C(F)F |
| InChI | InChI=1S/C9H3F5N2O2/c10-7(11)5-3(2-15)1-4(9(12,13)14)6(16-5)8(17)18/h1,7H,(H,17,18) |
| InChIKey | CMVAOJQIMFQTGU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.12 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |