C11H6F5NO2 — CID 119020913
2-[2-cyano-5-(difluoromethyl)-4-(trifluoromethyl)phenyl]acetic acid (PubChem CID 119020913) has the molecular formula C11H6F5NO2 and a molecular weight of 279.16 g/mol. Its IUPAC name is 2-[2-cyano-5-(difluoromethyl)-4-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-[2-cyano-5-(difluoromethyl)-4-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 119020913 |
| Molecular Formula | C11H6F5NO2 |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 2-[2-cyano-5-(difluoromethyl)-4-(trifluoromethyl)phenyl]acetic acid |
| SMILES | N#Cc1cc(C(F)(F)F)c(C(F)F)cc1CC(=O)O |
| InChI | InChI=1S/C11H6F5NO2/c12-10(13)7-1-5(3-9(18)19)6(4-17)2-8(7)11(14,15)16/h1-2,10H,3H2,(H,18,19) |
| InChIKey | VHFOPQMGUOXXDZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |