C19H27FN4O2 — CID 133108056
N-[3-(cyclohexylamino)-3-oxopropyl]-3-(2-fluorophenyl)pyrazolidine-4-carboxamide (PubChem CID 133108056) has the molecular formula C19H27FN4O2 and a molecular weight of 362.45 g/mol. Its IUPAC name is N-[3-(cyclohexylamino)-3-oxopropyl]-3-(2-fluorophenyl)pyrazolidine-4-carboxamide.
| Compound Name | N-[3-(cyclohexylamino)-3-oxopropyl]-3-(2-fluorophenyl)pyrazolidine-4-carboxamide |
|---|---|
| PubChem CID | 133108056 |
| Molecular Formula | C19H27FN4O2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | N-[3-(cyclohexylamino)-3-oxopropyl]-3-(2-fluorophenyl)pyrazolidine-4-carboxamide |
| SMILES | O=C(CCNC(=O)C1CNNC1c1ccccc1F)NC1CCCCC1 |
| InChI | InChI=1S/C19H27FN4O2/c20-16-9-5-4-8-14(16)18-15(12-22-24-18)19(26)21-11-10-17(25)23-13-6-2-1-3-7-13/h4-5,8-9,13,15,18,22,24H,1-3,6-7,10-12H2,(H,21,26)(H,23,25) |
| InChIKey | ZSHKVKWPXRHQPZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |