C18H23N5O2 — CID 133108342
N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ylmethyl)-N-methyl-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 133108342) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ylmethyl)-N-methyl-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ylmethyl)-N-methyl-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 133108342 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ylmethyl)-N-methyl-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | CN(CC1NNC2CCCCC21)C(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C18H23N5O2/c1-23(10-15-13-8-4-5-9-14(13)19-20-15)18(25)16-11-6-2-3-7-12(11)17(24)22-21-16/h2-3,6-7,13-15,19-20H,4-5,8-10H2,1H3,(H,22,24) |
| InChIKey | UUWOLVDKPDWAQW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |