C16H18N4O3S — CID 133110114
N-(4-methylsulfonylphenyl)-5-phenyltriazolidine-4-carboxamide (PubChem CID 133110114) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-5-phenyltriazolidine-4-carboxamide.
| Compound Name | N-(4-methylsulfonylphenyl)-5-phenyltriazolidine-4-carboxamide |
|---|---|
| PubChem CID | 133110114 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-5-phenyltriazolidine-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)C2NNNC2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H18N4O3S/c1-24(22,23)13-9-7-12(8-10-13)17-16(21)15-14(18-20-19-15)11-5-3-2-4-6-11/h2-10,14-15,18-20H,1H3,(H,17,21) |
| InChIKey | INUDCZAEEDCPFH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |