C16H17ClF3NO3 — CID 133110746
[(3aS,5R,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-chloro-5-(trifluoromethyl)phenyl]methanone (PubChem CID 133110746) has the molecular formula C16H17ClF3NO3 and a molecular weight of 363.76 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-chloro-5-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-chloro-5-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 133110746 |
| Molecular Formula | C16H17ClF3NO3 |
| Molecular Weight | 363.76 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-chloro-5-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)ccc1Cl)N1C[C@H]2C[C@@H](O)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C16H17ClF3NO3/c17-12-2-1-10(16(18,19)20)5-11(12)15(24)21-6-8-3-13(22)14(23)4-9(8)7-21/h1-2,5,8-9,13-14,22-23H,3-4,6-7H2/t8-,9+,13-,14-/m1/s1 |
| InChIKey | OMTMMPDHTYAAFP-HZZFPTLFSA-N |
| XLogP | 2.56 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.76 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |