C22H23N3O4 — CID 133110929
[(2S,3S,6S)-3-(1,3-benzodioxol-5-yl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(3-hydroxy-4-pyridinyl)methanone (PubChem CID 133110929) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is [(2S,3S,6S)-3-(1,3-benzodioxol-5-yl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(3-hydroxy-4-pyridinyl)methanone.
| Compound Name | [(2S,3S,6S)-3-(1,3-benzodioxol-5-yl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(3-hydroxy-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 133110929 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [(2S,3S,6S)-3-(1,3-benzodioxol-5-yl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-(3-hydroxy-4-pyridinyl)methanone |
| SMILES | O=C(c1ccncc1O)N1C[C@H](c2ccc3c(c2)OCO3)[C@H]2[C@@H]1C1CCN2CC1 |
| InChI | InChI=1S/C22H23N3O4/c26-17-10-23-6-3-15(17)22(27)25-11-16(14-1-2-18-19(9-14)29-12-28-18)21-20(25)13-4-7-24(21)8-5-13/h1-3,6,9-10,13,16,20-21,26H,4-5,7-8,11-12H2/t16-,20+,21+/m1/s1 |
| InChIKey | DUEQBGQNPFLIKE-CZAAIQMYSA-N |
| XLogP | 2.22 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |