C21H22N2O3S — CID 133123326
[(2S,3S,6S)-3-(1,3-benzodioxol-5-yl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-thiophen-3-ylmethanone (PubChem CID 133123326) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is [(2S,3S,6S)-3-(1,3-benzodioxol-5-yl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-thiophen-3-ylmethanone.
| Compound Name | [(2S,3S,6S)-3-(1,3-benzodioxol-5-yl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 133123326 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [(2S,3S,6S)-3-(1,3-benzodioxol-5-yl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1C[C@H](c2ccc3c(c2)OCO3)[C@H]2[C@@H]1C1CCN2CC1 |
| InChI | InChI=1S/C21H22N2O3S/c24-21(15-5-8-27-11-15)23-10-16(14-1-2-17-18(9-14)26-12-25-17)20-19(23)13-3-6-22(20)7-4-13/h1-2,5,8-9,11,13,16,19-20H,3-4,6-7,10,12H2/t16-,19+,20+/m1/s1 |
| InChIKey | YNGJOWQDFAONDQ-UXPWSPDFSA-N |
| XLogP | 3.18 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |