C23H23FN2O3 — CID 133111092
1,3-benzodioxol-5-yl-[(2S,3S,6S)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone (PubChem CID 133111092) has the molecular formula C23H23FN2O3 and a molecular weight of 394.45 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[(2S,3S,6S)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[(2S,3S,6S)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone |
|---|---|
| PubChem CID | 133111092 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[(2S,3S,6S)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1C[C@H](c2ccc(F)cc2)[C@H]2[C@@H]1C1CCN2CC1 |
| InChI | InChI=1S/C23H23FN2O3/c24-17-4-1-14(2-5-17)18-12-26(21-15-7-9-25(10-8-15)22(18)21)23(27)16-3-6-19-20(11-16)29-13-28-19/h1-6,11,15,18,21-22H,7-10,12-13H2/t18-,21+,22+/m1/s1 |
| InChIKey | JEDAVTHQYUPKKV-COPCDDAFSA-N |
| XLogP | 3.26 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |