C15H23N5O5S — CID 133111684
1-[(4aR,7aS)-4-(2-methoxyacetyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-4-(1,2,4-triazol-1-yl)butan-1-one (PubChem CID 133111684) has the molecular formula C15H23N5O5S and a molecular weight of 385.45 g/mol. Its IUPAC name is 1-[(4aR,7aS)-4-(2-methoxyacetyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-4-(1,2,4-triazol-1-yl)butan-1-one.
| Compound Name | 1-[(4aR,7aS)-4-(2-methoxyacetyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-4-(1,2,4-triazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 133111684 |
| Molecular Formula | C15H23N5O5S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-[(4aR,7aS)-4-(2-methoxyacetyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-4-(1,2,4-triazol-1-yl)butan-1-one |
| SMILES | COCC(=O)N1CCN(C(=O)CCCn2cncn2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C15H23N5O5S/c1-25-7-15(22)20-6-5-19(12-8-26(23,24)9-13(12)20)14(21)3-2-4-18-11-16-10-17-18/h10-13H,2-9H2,1H3/t12-,13+/m1/s1 |
| InChIKey | OTEZFIHSNSBKTR-OLZOCXBDSA-N |
| XLogP | -1.46 |
| TPSA | 114.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |