C15H25N5O4S — CID 72861981
1-[(4aS,7aR)-6,6-dioxo-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methoxyethanone (PubChem CID 72861981) has the molecular formula C15H25N5O4S and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-[(4aS,7aR)-6,6-dioxo-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methoxyethanone.
| Compound Name | 1-[(4aS,7aR)-6,6-dioxo-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 72861981 |
| Molecular Formula | C15H25N5O4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[(4aS,7aR)-6,6-dioxo-1-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCN(Cc2nncn2C(C)C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H25N5O4S/c1-11(2)20-10-16-17-14(20)6-18-4-5-19(15(21)7-24-3)13-9-25(22,23)8-12(13)18/h10-13H,4-9H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | HDKAUSOCNRPPJO-QWHCGFSZSA-N |
| XLogP | -0.68 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |