C13H21N5O4S — CID 72894830
1-[(4aS,7aR)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methoxyethanone (PubChem CID 72894830) has the molecular formula C13H21N5O4S and a molecular weight of 343.41 g/mol. Its IUPAC name is 1-[(4aS,7aR)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methoxyethanone.
| Compound Name | 1-[(4aS,7aR)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 72894830 |
| Molecular Formula | C13H21N5O4S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-[(4aS,7aR)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCN(Cc2n[nH]c(C)n2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C13H21N5O4S/c1-9-14-12(16-15-9)5-17-3-4-18(13(19)6-22-2)11-8-23(20,21)7-10(11)17/h10-11H,3-8H2,1-2H3,(H,14,15,16)/t10-,11+/m0/s1 |
| InChIKey | CSGLKENHMCPDQY-WDEREUQCSA-N |
| XLogP | -1.43 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |