C14H23N5O3S — CID 72841359
1-[(4aS,7aR)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one (PubChem CID 72841359) has the molecular formula C14H23N5O3S and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-[(4aS,7aR)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(4aS,7aR)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 72841359 |
| Molecular Formula | C14H23N5O3S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-[(4aS,7aR)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one |
| SMILES | Cc1nc(CN2CCN(C(=O)C(C)C)[C@@H]3CS(=O)(=O)C[C@@H]32)n[nH]1 |
| InChI | InChI=1S/C14H23N5O3S/c1-9(2)14(20)19-5-4-18(6-13-15-10(3)16-17-13)11-7-23(21,22)8-12(11)19/h9,11-12H,4-8H2,1-3H3,(H,15,16,17)/t11-,12+/m0/s1 |
| InChIKey | UFWASBGMHVLVOR-NWDGAFQWSA-N |
| XLogP | -0.42 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |