C13H22N6O3S — CID 72904801
(4aS,7aR)-N,N-dimethyl-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide (PubChem CID 72904801) has the molecular formula C13H22N6O3S and a molecular weight of 342.43 g/mol. Its IUPAC name is (4aS,7aR)-N,N-dimethyl-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide.
| Compound Name | (4aS,7aR)-N,N-dimethyl-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 72904801 |
| Molecular Formula | C13H22N6O3S |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (4aS,7aR)-N,N-dimethyl-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
| SMILES | Cc1nc(CN2CCN(C(=O)N(C)C)[C@@H]3CS(=O)(=O)C[C@@H]32)n[nH]1 |
| InChI | InChI=1S/C13H22N6O3S/c1-9-14-12(16-15-9)6-18-4-5-19(13(20)17(2)3)11-8-23(21,22)7-10(11)18/h10-11H,4-8H2,1-3H3,(H,14,15,16)/t10-,11+/m0/s1 |
| InChIKey | LHOXRCXWLMNYIB-WDEREUQCSA-N |
| XLogP | -0.92 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |