C13H20ClN5O3S — CID 70719070
1-[(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-one (PubChem CID 70719070) has the molecular formula C13H20ClN5O3S and a molecular weight of 361.86 g/mol. Its IUPAC name is 1-[(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-one.
| Compound Name | 1-[(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 70719070 |
| Molecular Formula | C13H20ClN5O3S |
| Molecular Weight | 361.86 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 1-[(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-one |
| SMILES | CCN1CCN(C(=O)CCc2nc(Cl)n[nH]2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C13H20ClN5O3S/c1-2-18-5-6-19(10-8-23(21,22)7-9(10)18)12(20)4-3-11-15-13(14)17-16-11/h9-10H,2-8H2,1H3,(H,15,16,17)/t9-,10+/m1/s1 |
| InChIKey | JFUKDSVMVKWMMP-ZJUUUORDSA-N |
| XLogP | -0.28 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.86 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |