C16H27N5O3S — CID 70778232
1-[(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(5-methyl-1H-1,2,4-triazol-3-yl)propan-1-one (PubChem CID 70778232) has the molecular formula C16H27N5O3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-[(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(5-methyl-1H-1,2,4-triazol-3-yl)propan-1-one.
| Compound Name | 1-[(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(5-methyl-1H-1,2,4-triazol-3-yl)propan-1-one |
|---|---|
| PubChem CID | 70778232 |
| Molecular Formula | C16H27N5O3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 1-[(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(5-methyl-1H-1,2,4-triazol-3-yl)propan-1-one |
| SMILES | Cc1nc(CCC(=O)N2CCN(CC(C)C)[C@@H]3CS(=O)(=O)C[C@@H]32)n[nH]1 |
| InChI | InChI=1S/C16H27N5O3S/c1-11(2)8-20-6-7-21(14-10-25(23,24)9-13(14)20)16(22)5-4-15-17-12(3)18-19-15/h11,13-14H,4-10H2,1-3H3,(H,17,18,19)/t13-,14+/m1/s1 |
| InChIKey | PLIIDBMCFYBSEL-KGLIPLIRSA-N |
| XLogP | 0.01 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |