C15H25N5O3S2 — CID 70736793
1-[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone (PubChem CID 70736793) has the molecular formula C15H25N5O3S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 70736793 |
| Molecular Formula | C15H25N5O3S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 1-[(4aR,7aS)-6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| SMILES | CCCN1CCN(C(=O)CSc2n[nH]c(CC)n2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H25N5O3S2/c1-3-5-19-6-7-20(12-10-25(22,23)9-11(12)19)14(21)8-24-15-16-13(4-2)17-18-15/h11-12H,3-10H2,1-2H3,(H,16,17,18)/t11-,12+/m1/s1 |
| InChIKey | KNGYELIUVQHXNY-NEPJUHHUSA-N |
| XLogP | 0.18 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |