C22H26N4O2 — CID 133114345
(2,6-dimethylpyrimidin-4-yl)-[(2S,3S,6S)-3-(3-hydroxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone (PubChem CID 133114345) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is (2,6-dimethylpyrimidin-4-yl)-[(2S,3S,6S)-3-(3-hydroxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone.
| Compound Name | (2,6-dimethylpyrimidin-4-yl)-[(2S,3S,6S)-3-(3-hydroxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone |
|---|---|
| PubChem CID | 133114345 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | (2,6-dimethylpyrimidin-4-yl)-[(2S,3S,6S)-3-(3-hydroxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]methanone |
| SMILES | Cc1cc(C(=O)N2C[C@H](c3cccc(O)c3)[C@H]3[C@@H]2C2CCN3CC2)nc(C)n1 |
| InChI | InChI=1S/C22H26N4O2/c1-13-10-19(24-14(2)23-13)22(28)26-12-18(16-4-3-5-17(27)11-16)21-20(26)15-6-8-25(21)9-7-15/h3-5,10-11,15,18,20-21,27H,6-9,12H2,1-2H3/t18-,20+,21+/m1/s1 |
| InChIKey | ZIFWMKGOTGHVPP-GIVPXCGWSA-N |
| XLogP | 2.50 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |