C22H28N4O2 — CID 133129172
2-(3,5-dimethylpyrazol-1-yl)-1-[(2S,3S,6S)-3-(3-hydroxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]ethanone (PubChem CID 133129172) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-1-[(2S,3S,6S)-3-(3-hydroxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]ethanone.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-1-[(2S,3S,6S)-3-(3-hydroxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]ethanone |
|---|---|
| PubChem CID | 133129172 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-1-[(2S,3S,6S)-3-(3-hydroxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]ethanone |
| SMILES | Cc1cc(C)n(CC(=O)N2C[C@H](c3cccc(O)c3)[C@H]3[C@@H]2C2CCN3CC2)n1 |
| InChI | InChI=1S/C22H28N4O2/c1-14-10-15(2)26(23-14)13-20(28)25-12-19(17-4-3-5-18(27)11-17)22-21(25)16-6-8-24(22)9-7-16/h3-5,10-11,16,19,21-22,27H,6-9,12-13H2,1-2H3/t19-,21+,22+/m1/s1 |
| InChIKey | DUOBDHXOWIRSGK-HJNYFJLDSA-N |
| XLogP | 2.29 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |