C17H22F2N4O2 — CID 133114524
(1R,5S)-6-N-(3,4-difluorophenyl)-3-N,3-N-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3,6-dicarboxamide (PubChem CID 133114524) has the molecular formula C17H22F2N4O2 and a molecular weight of 352.39 g/mol. Its IUPAC name is (1R,5S)-6-N-(3,4-difluorophenyl)-3-N,3-N-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3,6-dicarboxamide.
| Compound Name | (1R,5S)-6-N-(3,4-difluorophenyl)-3-N,3-N-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3,6-dicarboxamide |
|---|---|
| PubChem CID | 133114524 |
| Molecular Formula | C17H22F2N4O2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (1R,5S)-6-N-(3,4-difluorophenyl)-3-N,3-N-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3,6-dicarboxamide |
| SMILES | CN(C)C(=O)N1C[C@H]2CC[C@@H](C1)N(C(=O)Nc1ccc(F)c(F)c1)C2 |
| InChI | InChI=1S/C17H22F2N4O2/c1-21(2)17(25)22-8-11-3-5-13(10-22)23(9-11)16(24)20-12-4-6-14(18)15(19)7-12/h4,6-7,11,13H,3,5,8-10H2,1-2H3,(H,20,24)/t11-,13+/m1/s1 |
| InChIKey | IWEDNUDFDZZIOW-YPMHNXCESA-N |
| XLogP | 2.57 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |