C22H27N3O2 — CID 133114880
(3R,4R)-1-[(1-ethylbenzimidazol-2-yl)methyl]-4-(3-methoxyphenyl)piperidin-3-ol (PubChem CID 133114880) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is (3R,4R)-1-[(1-ethylbenzimidazol-2-yl)methyl]-4-(3-methoxyphenyl)piperidin-3-ol.
| Compound Name | (3R,4R)-1-[(1-ethylbenzimidazol-2-yl)methyl]-4-(3-methoxyphenyl)piperidin-3-ol |
|---|---|
| PubChem CID | 133114880 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (3R,4R)-1-[(1-ethylbenzimidazol-2-yl)methyl]-4-(3-methoxyphenyl)piperidin-3-ol |
| SMILES | CCn1c(CN2CC[C@H](c3cccc(OC)c3)[C@@H](O)C2)nc2ccccc21 |
| InChI | InChI=1S/C22H27N3O2/c1-3-25-20-10-5-4-9-19(20)23-22(25)15-24-12-11-18(21(26)14-24)16-7-6-8-17(13-16)27-2/h4-10,13,18,21,26H,3,11-12,14-15H2,1-2H3/t18-,21+/m1/s1 |
| InChIKey | VZLOIDFBCMDDIS-NQIIRXRSSA-N |
| XLogP | 3.42 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |