C23H27N5O3 — CID 133115221
N-[[7-[(1S,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]-2-methoxybenzamide (PubChem CID 133115221) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[[7-[(1S,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]-2-methoxybenzamide.
| Compound Name | N-[[7-[(1S,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 133115221 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-[[7-[(1S,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCc1nnc2n1CCN(C(=O)[C@@H]1C[C@H]3C=C[C@@H]1C3)CC2 |
| InChI | InChI=1S/C23H27N5O3/c1-31-19-5-3-2-4-17(19)22(29)24-14-21-26-25-20-8-9-27(10-11-28(20)21)23(30)18-13-15-6-7-16(18)12-15/h2-7,15-16,18H,8-14H2,1H3,(H,24,29)/t15-,16+,18+/m0/s1 |
| InChIKey | XFWSQSPVKPAJRQ-LZLYRXPVSA-N |
| XLogP | 1.81 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|