C22H26N6O4 — CID 29211334
N-[[7-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]pyridine-4-carboxamide (PubChem CID 29211334) has the molecular formula C22H26N6O4 and a molecular weight of 438.49 g/mol. Its IUPAC name is N-[[7-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]pyridine-4-carboxamide.
| Compound Name | N-[[7-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 29211334 |
| Molecular Formula | C22H26N6O4 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | N-[[7-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]pyridine-4-carboxamide |
| SMILES | COc1cc(CN2CCc3nnc(CNC(=O)c4ccncc4)n3CC2)cc(OC)c1O |
| InChI | InChI=1S/C22H26N6O4/c1-31-17-11-15(12-18(32-2)21(17)29)14-27-8-5-19-25-26-20(28(19)10-9-27)13-24-22(30)16-3-6-23-7-4-16/h3-4,6-7,11-12,29H,5,8-10,13-14H2,1-2H3,(H,24,30) |
| InChIKey | LUQBBSYMGQEWNV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |