C24H30N6O4 — CID 26280459
N-[2-[7-[(3,4,5-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]pyridine-3-carboxamide (PubChem CID 26280459) has the molecular formula C24H30N6O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-[2-[7-[(3,4,5-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[7-[(3,4,5-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 26280459 |
| Molecular Formula | C24H30N6O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | N-[2-[7-[(3,4,5-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]ethyl]pyridine-3-carboxamide |
| SMILES | COc1cc(CN2CCc3nnc(CCNC(=O)c4cccnc4)n3CC2)cc(OC)c1OC |
| InChI | InChI=1S/C24H30N6O4/c1-32-19-13-17(14-20(33-2)23(19)34-3)16-29-10-7-22-28-27-21(30(22)12-11-29)6-9-26-24(31)18-5-4-8-25-15-18/h4-5,8,13-15H,6-7,9-12,16H2,1-3H3,(H,26,31) |
| InChIKey | UNEULVKBKFOQKU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |